2,6-DICHLOROSTYRENE manufacturers
- 2,6-DICHLOROSTYRENE
-
-
2026-06-30
- CAS:28469-92-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
|
| | 2,6-DICHLOROSTYRENE Basic information |
| Product Name: | 2,6-DICHLOROSTYRENE | | Synonyms: | 1-Vinyl-2,6-dichlorobenzene;2,6-Dichloro-1-ethenylbenzene;2,6-Dichloro-1-vinylbenzene;1,3-Dichloro-2-ethenylbenzene;NSC 89716;2,6-DICHOROSTYRENE;2,6-Dichlorostyrene,98%,stabilized;2,6-Dichlorostyrene | | CAS: | 28469-92-3 | | MF: | C8H6Cl2 | | MW: | 173.04 | | EINECS: | 249-039-7 | | Product Categories: | Styrenes | | Mol File: | 28469-92-3.mol |  |
| | 2,6-DICHLOROSTYRENE Chemical Properties |
| Melting point | 89°C | | Boiling point | 88-90 °C/8 mmHg (lit.) | | density | 1.267 g/mL at 25 °C (lit.) | | refractive index | 1.573-1.575 | | RTECS | CZ4907000 | | Fp | 71 °C | | storage temp. | 2-8°C | | form | liquid | | Appearance | Colorless to light yellow Liquid | | Water Solubility | Immiscible with water. | | BRN | 1931527 | | InChI | InChI=1S/C8H6Cl2/c1-2-6-7(9)4-3-5-8(6)10/h2-5H,1H2 | | InChIKey | YJCVRMIJBXTMNR-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=CC(Cl)=C1C=C | | CAS DataBase Reference | 28469-92-3(CAS DataBase Reference) | | EPA Substance Registry System | 2,6-Dichlorostyrene (28469-92-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-24/25 | | WGK Germany | 3 | | HS Code | 29039990 | | Storage Class | 10 - Combustible liquids |
| | 2,6-DICHLOROSTYRENE Usage And Synthesis |
| Chemical Properties | clear colourless liquid | | Uses | 2,6-Dichlorostyrene is used in the preparation of 1,3-dichloro-2-(1,2-dibromo-ethyl)-benzene by bromination reaction using bromine. | | Purification Methods | Purify the styrene by fractional crystallisation from the melt and by distillation in vacuo. [Beilstein 5 III 1174.] |
| | 2,6-DICHLOROSTYRENE Preparation Products And Raw materials |
|