| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,1,2,2-Tetrakis(4-hydroxyphenyl)ethane Basic information |
| Product Name: | 1,1,2,2-Tetrakis(4-hydroxyphenyl)ethane | | Synonyms: | 4,4’,4’’,4’’’-(1,2-ethanediylidene)tetrakis-pheno;4,4’,4’’,4’’’-(1,2-ethanediylidene)tetrakis-Phenol;4,4’,4’’,4’’’-Ethanediylidenetetraphenol;1,1,2,2-ETHANETETRA-P-PHENOL;ethanediylidenetetrakisphenol;1,1,2,2-Tetrakis(4-hydroxyphenyl)ethane;4,4',4'',4'''-(1,1,2,2-Ethanetetrayl)tetraphenol;4,4',4'',4'''-(1,1,2,2-Ethanetetryl)tetrakis(phenol) | | CAS: | 7727-33-5 | | MF: | C26H22O4 | | MW: | 398.45 | | EINECS: | 231-782-3 | | Product Categories: | Organic Building Blocks;Oxygen Compounds;Polyols;Building Blocks;Chemical Synthesis;Aromatics Compounds;Aromatics | | Mol File: | 7727-33-5.mol |  |
| | 1,1,2,2-Tetrakis(4-hydroxyphenyl)ethane Chemical Properties |
| Melting point | >250°C (dec.) | | Boiling point | 566.4±45.0 °C(Predicted) | | density | 1.309±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | powder | | pka | 9.66±0.10(Predicted) | | color | off-white | | Stability: | Hygroscopic | | InChI | InChI=1S/C26H22O4/c27-21-9-1-17(2-10-21)25(18-3-11-22(28)12-4-18)26(19-5-13-23(29)14-6-19)20-7-15-24(30)16-8-20/h1-16,25-30H | | InChIKey | HDPBBNNDDQOWPJ-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(O)C=C1)(C1=CC=C(O)C=C1)C(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1 | | EPA Substance Registry System | Phenol, 4,4',4'',4'''-(1,2-ethanediylidene)tetrakis- (7727-33-5) |
| Hazard Codes | Xn,N,Xi | | Risk Statements | 40-50/53-41 | | Safety Statements | 36/37-61-60-39-26 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 |
| | 1,1,2,2-Tetrakis(4-hydroxyphenyl)ethane Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 1,1,2,2-Tetrakis(p-hydroxyphenyl)ethane (cas# 7727-33-5) is a compound useful in organic synthesis. |
| | 1,1,2,2-Tetrakis(4-hydroxyphenyl)ethane Preparation Products And Raw materials |
|