| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | 1,1,2,2-TETRAPHENYLETHANE Basic information |
| Product Name: | 1,1,2,2-TETRAPHENYLETHANE | | Synonyms: | (1,2,2-Triphenylethyl)benzene;alpha,alpha,beta,beta-Tetraphenylethane;benzene,1,1’,1’’,1’’’-(1,2-ethanediylidene)tetra-;Bibenzhydryl;Ethane, 1,1,2,2-tetraphenyl-;ethane,1,1,2,2-tetraphenyl-;sym-Tetraphenylethane;α,α,β,β-tetraphenylethane | | CAS: | 632-50-8 | | MF: | C26H22 | | MW: | 334.45 | | EINECS: | | | Product Categories: | | | Mol File: | 632-50-8.mol |  |
| | 1,1,2,2-TETRAPHENYLETHANE Chemical Properties |
| Melting point | 212°C | | Boiling point | 360°C | | density | 1.0862 (estimate) | | refractive index | 1.8430 (estimate) | | InChI | InChI=1S/C26H22/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22)26(23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20,25-26H | | InChIKey | RUGHUJBHQWALKM-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(C1=CC=CC=C1)C(C1=CC=CC=C1)C1=CC=CC=C1 |
| | 1,1,2,2-TETRAPHENYLETHANE Usage And Synthesis |
| | 1,1,2,2-TETRAPHENYLETHANE Preparation Products And Raw materials |
|