bicyclo[1.1.1]pentan-1-ylmethanol manufacturers
|
| | bicyclo[1.1.1]pentan-1-ylmethanol Basic information |
| Product Name: | bicyclo[1.1.1]pentan-1-ylmethanol | | Synonyms: | bicyclo[1.1.1]pentan-1-ylmethanol;(Bicyclo[1.1.1]pent-1-yl)methanol;Bicyclo[1.1.1]pentane-1-methanol;1-Hydroxymethylbicyclo<1.1.1>pentane;3-bicyclo[1.1.1]pentanylmethanol;bicyclo[1.1.1]pentane-1-yl methanol;bicyclo[1.1.1]pentylmethanolbicyclo[1.1.1]pentan-1-ylmethanol;1-bicyclo[1.1.1]pentanylmethanol | | CAS: | 22287-32-7 | | MF: | C6H10O | | MW: | 98.14 | | EINECS: | | | Product Categories: | | | Mol File: | 22287-32-7.mol | ![bicyclo[1.1.1]pentan-1-ylmethanol Structure](CAS/GIF/22287-32-7.gif) |
| | bicyclo[1.1.1]pentan-1-ylmethanol Chemical Properties |
| storage temp. | Store at room temperature | | form | liquid | | color | Clear, colourless | | InChI | InChI=1S/C6H10O/c7-4-6-1-5(2-6)3-6/h5,7H,1-4H2 | | InChIKey | PTCSNXOIOPVZMT-UHFFFAOYSA-N | | SMILES | C12(CO)CC(C1)C2 |
| | bicyclo[1.1.1]pentan-1-ylmethanol Usage And Synthesis |
| | bicyclo[1.1.1]pentan-1-ylmethanol Preparation Products And Raw materials |
|