|
|
| | Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid dianhydride Basic information |
| Product Name: | Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid dianhydride | | Synonyms: | 4,10-DIOXATETRACYCLO[5.5.2.0(2,6).0(8,12)]TETRADEC-13-ENE-3,5,9,11-TETRAONE;Bicyclooctenetetracarboxylicaciddianhydride;BICYCLO[2.2.2]OCT-7-ENE-2,3,5,6-TETRACARBOYLIC ACID DIANHYDRIDE;bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic dianhydrid;Bicyclo2.2.2üoct-7-ene-2,3,5,6-tetracarboxylic dianhydride, 97%;3,6-Ethenocyclohexane-1,2,4,5-tetracarboxylic acid 1,2:4,5-dianhydride;3a,4,4a,7a,8,8a-Hexahydro-4,8-etheno-1H,3H-benzo[1,2-c:4,5-c']difuran-1,3,5,7-tetrone;Bicyclo[2.2.2]octa-2-ene-5,6,7,8-tetracarboxylic acid 5,6:7,8-dianhydride | | CAS: | 1719-83-1 | | MF: | C12H8O6 | | MW: | 248.19 | | EINECS: | 217-009-2 | | Product Categories: | Anhydride Monomers;Monomers;Polymer Science;Fluorenes, etc. (reagent for high-performance polymer research);Functional Materials;Reagent for High-Performance Polymer Research;PI | | Mol File: | 1719-83-1.mol | ![Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid dianhydride Structure](CAS/GIF/1719-83-1.gif) |
| | Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid dianhydride Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 351.26°C (rough estimate) | | density | 1.4501 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Store below +30°C. | | form | powder to crystal | | color | White to Almost white | | Water Solubility | Soluble in water | | Sensitive | Moisture Sensitive | | BRN | 294213 | | InChI | InChI=1S/C12H8O6/c13-9-5-3-1-2-4(7(5)11(15)17-9)8-6(3)10(14)18-12(8)16/h1-8H | | InChIKey | XLOGCGOPKPCECW-UHFFFAOYSA-N | | SMILES | O1C(=O)C2C3C=CC(C4C(=O)OC(=O)C43)C2C1=O | | CAS DataBase Reference | 1719-83-1(CAS DataBase Reference) | | NIST Chemistry Reference | Bicyclo[2.2.2]-7-octene-2,3,5,6-tetracarboxylic acid dianhydride(1719-83-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 2917 20 00 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid dianhydride Usage And Synthesis |
| Chemical Properties | white to beige powder | | Uses | Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic dianhydride is used to prepare the thermo-cured cycloaliphatic polyamic acid and photo-cured cycloaliphatic polyamic ester, which were then converted to cycloaliphatic polyimide film. |
| | Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid dianhydride Preparation Products And Raw materials |
|