|
|
| | 2-Bromo-1-(5-methyl-3-phenylisoxazol-4-yl)ethan-1-one Basic information |
| | 2-Bromo-1-(5-methyl-3-phenylisoxazol-4-yl)ethan-1-one Chemical Properties |
| Melting point | 46 °C | | Boiling point | 402.5±45.0 °C(Predicted) | | density | 1.461±0.06 g/cm3(Predicted) | | Fp | >110°C | | pka | -4.52±0.50(Predicted) | | form | powder | | InChI | 1S/C12H10BrNO2/c1-8-11(10(15)7-13)12(14-16-8)9-5-3-2-4-6-9/h2-6H,7H2,1H3 | | InChIKey | QKOOGOQWNSWJFQ-UHFFFAOYSA-N | | SMILES | Cc1onc(-c2ccccc2)c1C(=O)CBr | | CAS DataBase Reference | 104777-39-1(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-Bromo-1-(5-methyl-3-phenylisoxazol-4-yl)ethan-1-one Usage And Synthesis |
| | 2-Bromo-1-(5-methyl-3-phenylisoxazol-4-yl)ethan-1-one Preparation Products And Raw materials |
|