|
|
| | trans-p-Methoxycinnamaldehyde Basic information |
| | trans-p-Methoxycinnamaldehyde Chemical Properties |
| Melting point | 55-60 °C(lit.) | | Boiling point | 145 °C7 mm Hg(lit.) | | density | 1.0281 (rough estimate) | | refractive index | 1.6000 (estimate) | | Fp | 160°C/3mm | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Crystalline Powder or Chunks | | color | Orange-yellow | | Odor | at 100.00 %. spicy floral sweet cinnamon cherry vanilla | | Odor Type | spicy | | biological source | synthetic | | Water Solubility | Insoluble in water. | | Sensitive | Air Sensitive | | BRN | 1447540 | | Major Application | flavors and fragrances | | InChI | 1S/C10H10O2/c1-12-10-6-4-9(5-7-10)3-2-8-11/h2-8H,1H3/b3-2+ | | InChIKey | AXCXHFKZHDEKTP-NSCUHMNNSA-N | | SMILES | [H]C(=O)C(\[H])=C(/[H])c1ccc(OC)cc1 | | LogP | 2.07 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29124990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | trans-p-Methoxycinnamaldehyde Usage And Synthesis |
| Chemical Properties | orange-yellow crystalline powder or chunks | | Uses | trans-p-Methoxycinnamaldehyde is used in the food industry as a flavor and fragrance agent. It also acts as a nematicidal agent in certain organisms. | | Uses | trans-4-Methoxycinnamaldehyde is used as an intermediate in chemical research. | | General Description | trans-p-Methoxycinnamaldehyde is an aromatic aldehyde reported to be found in Korean mint. |
| | trans-p-Methoxycinnamaldehyde Preparation Products And Raw materials |
|