| Company Name: |
Varanous Labs Pvt Ltd
|
| Tel: |
+91-7036248882 |
| Email: |
bheemashankar.e@varanouslabs.com |
| Products Intro: |
Product Name:Deschloroethyl Bendamustine Hydrochloride
CAS:1797881-48-1
Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
|
| | Bendamustine Impurity 8 Basic information |
| Product Name: | Bendamustine Impurity 8 | | Synonyms: | Bendamustine Impurity 23 HCl (Bendamustine N-Alkylated Impurity HCl);Bendamustine Impurity 23 HCl;Bendamustine Impurity 8;Bendamustine impurity 26/Bendamustine N-Alkylated Impurity HCl/
Deschloroethyl Bendamustine HCl/4-(5-((2-chloroethyl)amino)-1-methyl-1H-benzo[d]imidazol-2-yl)butanoic acid hydrochloride;4-(5-((2-chloroethyl)amino)-1-methyl;Bendamustine USP Related Compound D;Bendamustine Related Compound D;1H-Benzimidazole-2-butanoic acid, 5-[(2-chloroethyl)amino]-1-methyl-, hydrochloride (1:1) | | CAS: | 1797881-48-1 | | MF: | C14H19Cl2N3O2 | | MW: | 332.22556 | | EINECS: | | | Product Categories: | | | Mol File: | 1797881-48-1.mol |  |
| | Bendamustine Impurity 8 Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Pale Orange | | Stability: | Hygroscopic | | Major Application | pharmaceutical | | InChI | InChI=1S/C14H18ClN3O2.ClH/c1-18-12-6-5-10(16-8-7-15)9-11(12)17-13(18)3-2-4-14(19)20;/h5-6,9,16H,2-4,7-8H2,1H3,(H,19,20);1H | | InChIKey | OPSTYBKPQZPYBQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCC1N(C)C2=CC=C(NCCCl)C=C2N=1.[H]Cl |
| WGK Germany | WGK 3 | | HS Code | 2933998350 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Carc. 2
Muta. 2
Repr. 1B |
| | Bendamustine Impurity 8 Usage And Synthesis |
| Uses | An impurity formed from the synthesis of Bendamustine (B132500). |
| | Bendamustine Impurity 8 Preparation Products And Raw materials |
|