|
|
| | 4,5-Bis(chloromethyl)-1,3-dioxol-2-one Basic information |
| Product Name: | 4,5-Bis(chloromethyl)-1,3-dioxol-2-one | | Synonyms: | 4,5-Bis(chloromethyl)-1,3-dioxol-2-one;Olmesartan Impurity 4;Olmesartan Impurity 58;Olmesartan Dichloromethyl Impurity;1,3-Dioxol-2-one, 4,5-bis(chloromethyl)-;4,5-Dichloromethyl-1,3-dioxol-2-one;4,5-bis(2-chloroethyl)-1,3-dioxolan-2-one;Olmesartan Impurity 4
4,5-bis(chloromethyl)-1,3-dioxol-2-one | | CAS: | 1443544-27-1 | | MF: | C5H4Cl2O3 | | MW: | 182.99 | | EINECS: | | | Product Categories: | | | Mol File: | 1443544-27-1.mol |  |
| | 4,5-Bis(chloromethyl)-1,3-dioxol-2-one Chemical Properties |
| Melting point | 72-74°C | | Boiling point | 205.8±50.0 °C(Predicted) | | density | 1.506±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | White to Pale Yellow | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C5H4Cl2O3/c6-1-3-4(2-7)10-5(8)9-3/h1-2H2 | | InChIKey | YKCNWFRALIHYLI-UHFFFAOYSA-N | | SMILES | O1C(CCl)=C(CCl)OC1=O |
| | 4,5-Bis(chloromethyl)-1,3-dioxol-2-one Usage And Synthesis |
| Uses | 4,5-Bis(chloromethyl)-1,3-dioxol-2-one is an impurity of Olmesartan Medoxomil (O550000), which is an angiotensin II receptor antagonist. Used as an anti-hypertensive. |
| | 4,5-Bis(chloromethyl)-1,3-dioxol-2-one Preparation Products And Raw materials |
|