| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
|
| | 2-(t-Butoxycarbonylamido)-1,3-bis (PFP-oxycarbonylethoxy)propane Basic information |
| Product Name: | 2-(t-Butoxycarbonylamido)-1,3-bis (PFP-oxycarbonylethoxy)propane | | Synonyms: | 2-(t-Butoxycarbonylamido)-1,3-bis (PFP-oxycarbonylethoxy)propane;C-NH-Boc-C-Bis-(C1-PEG1-PFP);(2,3,4,5,6-Pentafluorophenyl) 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]propoxy]propanoate | | CAS: | 1807521-01-2 | | MF: | C26H23F10NO8 | | MW: | 667.446752 | | EINECS: | | | Product Categories: | | | Mol File: | 1807521-01-2.mol |  |
| | 2-(t-Butoxycarbonylamido)-1,3-bis (PFP-oxycarbonylethoxy)propane Chemical Properties |
| Boiling point | 632.2±55.0 °C(Predicted) | | density | 1.456±0.06 g/cm3(Predicted) | | pka | 11.49±0.46(Predicted) |
| | 2-(t-Butoxycarbonylamido)-1,3-bis (PFP-oxycarbonylethoxy)propane Usage And Synthesis |
| Description | 2-(t-Butoxycarbonylamido)-1,3-bis(PFP-oxycarbonylethoxy)propane contains a Boc protected amino group and two PFP end groups. PFP group can react with primary amines to form a stable amide bond. | | Uses | C-NH-Boc-C-Bis-(C1-PEG1-PFP) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | IC 50 | PEGs; Alkyl/ether | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | 2-(t-Butoxycarbonylamido)-1,3-bis (PFP-oxycarbonylethoxy)propane Preparation Products And Raw materials |
|