|
|
| | BIS(O-TRIMETHYLSILYL)THYMINE Basic information |
| | BIS(O-TRIMETHYLSILYL)THYMINE Chemical Properties |
| Melting point | 73-75 °C(lit.) | | Boiling point | 127-130 °C18 mm Hg(lit.) | | density | 0.974±0.06 g/cm3(Predicted) | | pka | 1.50±0.29(Predicted) | | form | solid | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | 1S/C11H22N2O2Si2/c1-9-8-12-11(15-17(5,6)7)13-10(9)14-16(2,3)4/h8H,1-7H3 | | InChIKey | DRNUNECHVNIYHQ-UHFFFAOYSA-N | | SMILES | Cc1cnc(O[Si](C)(C)C)nc1O[Si](C)(C)C | | EPA Substance Registry System | Pyrimidine, 5-methyl-2,4-bis[(trimethylsilyl)oxy]- (7288-28-0) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | BIS(O-TRIMETHYLSILYL)THYMINE Usage And Synthesis |
| Chemical Properties | Colourless solid, very sensitive to moisture | | Uses | O,O′-Bis(trimethylsilyl)thymine is a reactive intermediate for the preparation of nucleosides. |
| | BIS(O-TRIMETHYLSILYL)THYMINE Preparation Products And Raw materials |
|