|
|
| | (4-Amino-3-fluoro-phenyl)-acetic acid Basic information |
| Product Name: | (4-Amino-3-fluoro-phenyl)-acetic acid | | Synonyms: | RARECHEM AL BO 2235;4-Amino-3-fluorobenzeneacetic acid;Benzeneacetic acid, 4-aMino-3-fluoro-;2-(4-amino-3-fluorophenyl)acetic acid;4-Amino-3-fluorophenylacetic acid 97%;(4-AMINO-3-FLUORO-PHENYL)-ACETIC ACID ISO 9001:2015 REACH;3-Fluoro-4-aminophenylacetic acid;methyl 2-(4-amino-3-fluorophenyl)acetate | | CAS: | 503315-77-3 | | MF: | C8H8FNO2 | | MW: | 169.15 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | Mol File |  |
| | (4-Amino-3-fluoro-phenyl)-acetic acid Chemical Properties |
| Boiling point | 323℃ | | density | 1.371 | | Fp | 149℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 4.47±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H8FNO2/c9-6-3-5(4-8(11)12)1-2-7(6)10/h1-3H,4,10H2,(H,11,12) | | InChIKey | HDUDZUAACDPSAF-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=C(N)C(F)=C1 |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2922498590 |
| | (4-Amino-3-fluoro-phenyl)-acetic acid Usage And Synthesis |
| | (4-Amino-3-fluoro-phenyl)-acetic acid Preparation Products And Raw materials |
|