|
|
| | Acrylamide-d5 Basic information |
| Product Name: | Acrylamide-d5 | | Synonyms: | N,N’-Methylenebis(acrylamide)-d6;Acrylamide-d5 in methanol;Pacritinib Impurity 15;Acrylamide-d5;Acrylamide-d5 | | CAS: | 108152-65-4 | | MF: | C3D5NO | | MW: | 76.11 | | EINECS: | | | Product Categories: | | | Mol File: | 108152-65-4.mol |  |
| | Acrylamide-d5 Chemical Properties |
| Melting point | 83-85°C | | storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Light Sensitive | | InChI | 1S/C3H5NO/c1-2-3(4)5/h2H,1H2,(H2,4,5)/i1D2,2D/hD2 | | InChIKey | HRPVXLWXLXDGHG-LUPFFDCSSA-N | | SMILES | [2H]N([2H])C(=O)\C([2H])=C(\[2H])[2H] |
| Hazard Codes | T | | Risk Statements | 45-46-20/21-25-36/38-43-48/23/24/25-62 | | Safety Statements | 53-45 | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Aquatic Chronic 3
Carc. 1B
Eye Irrit. 2
Muta. 1B
Repr. 2
Resp. Sens. 1
Skin Irrit. 2 |
| | Acrylamide-d5 Usage And Synthesis |
| Uses | Acrylamide-d5 is a useful reactant for preparation of temperature sensitive composite hydrogels. |
| | Acrylamide-d5 Preparation Products And Raw materials |
|