| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | D-[1-13C]Xylose Basic information |
| | D-[1-13C]Xylose Chemical Properties |
| Melting point | 152-154 °C(lit.) | | density | 1.508±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Refrigerator | | solubility | Methanol (Very Slightly, Heated), Water (Slightly) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D +15°, c =1 in H2O | | InChI | 1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4-,5/m1/s1/i5+1 | | InChIKey | SRBFZHDQGSBBOR-KOPVYNEGSA-N | | SMILES | O[C@@H]1CO[13CH](O)[C@H](O)[C@H]1O | | CAS Number Unlabeled | 58-86-6 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | D-[1-13C]Xylose Usage And Synthesis |
| Uses | D-[1-13C]Xylose is a labeled analog of D-Xylose, which is used in diagnostic malabsorption tests as well as in the production of Furfural. |
| | D-[1-13C]Xylose Preparation Products And Raw materials |
|