|
|
| | 1-BROMO-4-TERT-BUTOXYBENZENE Basic information |
| Product Name: | 1-BROMO-4-TERT-BUTOXYBENZENE | | Synonyms: | 1-BROMO-4-TERT-BUTOXYBENZENE;4-tert-Butoxybromobenzene;n-Butyl-(4-bromo)phenyl ether;p-Bromophenyl tert-butyl ether;p-tert-Butoxybromobenzene;4-Bromophenyl tert-butyl ether;1-Bromo-4-(tert-butoxy)benzene 98%;Benzene,1-bromo-4-(1,1-dimethylethoxy)- | | CAS: | 60876-70-2 | | MF: | C10H13BrO | | MW: | 229.11 | | EINECS: | 641-192-1 | | Product Categories: | | | Mol File: | 60876-70-2.mol |  |
| | 1-BROMO-4-TERT-BUTOXYBENZENE Chemical Properties |
| Melting point | 32-33°C | | Boiling point | 63-65°C 0,4mm | | density | 1.278±0.06 g/cm3(Predicted) | | refractive index | 1.5280 | | Fp | 63-65°C/0.4mm | | storage temp. | Sealed in dry,2-8°C | | form | solid | | color | Colourless | | Water Solubility | Not miscible or difficult to mix in water. | | BRN | 2516411 | | InChI | InChI=1S/C10H13BrO/c1-10(2,3)12-9-6-4-8(11)5-7-9/h4-7H,1-3H3 | | InChIKey | QIWQHUCUWNGYDZ-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(OC(C)(C)C)C=C1 |
| Provider | Language |
|
ALFA
| English |
| | 1-BROMO-4-TERT-BUTOXYBENZENE Usage And Synthesis |
| Chemical Properties | Light yellow liquid | | Uses | It is used in the stereoselective synthesis of four stereoisomers of β-Methoxytyrosine, a component of callipeltin A. |
| | 1-BROMO-4-TERT-BUTOXYBENZENE Preparation Products And Raw materials |
|