| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 5-Bromo-1,3-difluoro-2-methylbenzene Basic information |
| | 5-Bromo-1,3-difluoro-2-methylbenzene Chemical Properties |
| Boiling point | 176.0±35.0 °C(Predicted) | | density | 1.588±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H5BrF2/c1-4-6(9)2-5(8)3-7(4)10/h2-3H,1H3 | | InChIKey | NGINOAWMGMGBPJ-UHFFFAOYSA-N | | SMILES | C1(F)=CC(Br)=CC(F)=C1C |
| Hazard Codes | Xi | | HS Code | 2903998090 |
| | 5-Bromo-1,3-difluoro-2-methylbenzene Usage And Synthesis |
| Chemical Properties | Colorless and clear liquid |
| | 5-Bromo-1,3-difluoro-2-methylbenzene Preparation Products And Raw materials |
|