|
|
| | 6-METHOXY-4-METHYL-QUINOLIN-2-OL Basic information |
| Product Name: | 6-METHOXY-4-METHYL-QUINOLIN-2-OL | | Synonyms: | 6-METHOXY-4-METHYL-QUINOLIN-2-OL;2-Hydroxy-6-methoxy-4-methylquinoline;6-methoxy-4-methyl-1H-quinolin-2-one;6-methoxy-4-methyl-carbostyril;2(1H)-Quinolinone, 6-Methoxy-4-Methyl-;6-methoxy-4-methylquinolin-2(1H)-one | | CAS: | 5342-23-4 | | MF: | C11H11NO2 | | MW: | 189.21 | | EINECS: | | | Product Categories: | | | Mol File: | 5342-23-4.mol |  |
| | 6-METHOXY-4-METHYL-QUINOLIN-2-OL Chemical Properties |
| Melting point | 270 °C | | Boiling point | 391.6±42.0 °C(Predicted) | | density | 1.153±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder | | pka | 11.13±0.70(Predicted) | | color | Off-white | | InChI | InChI=1S/C11H11NO2/c1-7-5-11(13)12-10-4-3-8(14-2)6-9(7)10/h3-6H,1-2H3,(H,12,13) | | InChIKey | VGQWDNJRHAWUNX-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(OC)C=C2)C(C)=CC1=O |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2933499090 |
| | 6-METHOXY-4-METHYL-QUINOLIN-2-OL Usage And Synthesis |
| Uses | 6-Methoxy-4-methylcarbostyril is used in the synthesis of novel coumarin analogs which display nematicidal activity against five nematodes. Also used in the preparation of 4-methyl-2-oxo-1,2-dihydroquinolin-6-yl acetate which is an effective antiplatelet agent. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 11, p. 803, 1946 DOI: 10.1021/jo01176a024 |
| | 6-METHOXY-4-METHYL-QUINOLIN-2-OL Preparation Products And Raw materials |
|