|
|
| | 2,3,6,7,10,11-hexaaminotriphenylene Basic information |
| Product Name: | 2,3,6,7,10,11-hexaaminotriphenylene | | Synonyms: | 2,3,6,7,10,11-Triphenylenehexamine, hydrochloride (1:6);Triphenylene-2,3,6,7,10,11-hexaamine 6HCl;Triphenylene-2,3,6,7,10,11-hexaamine Hydrochloride;2,3,6,7,10,11-hexaaminotriphenylene HCl;Triphenylene-2,3,6,7,10,11-hexaamine 6HCl,HATP,2,3,6,7,10,11-hexaaminotriphenylene,2,3,6,7,10,11-hexaaminotriphenylene;DK7569;DK7330;2,3,6,7,10,11-Hexaaminotriphenyl hexahydrochloride | | CAS: | 1350518-27-2 | | MF: | C18H19ClN6 | | MW: | 354.84 | | EINECS: | | | Product Categories: | | | Mol File: | 1350518-27-2.mol |  |
| | 2,3,6,7,10,11-hexaaminotriphenylene Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C18H18N6.ClH/c19-13-1-7-8(2-14(13)20)10-4-17(23)18(24)6-12(10)11-5-16(22)15(21)3-9(7)11;/h1-6H,19-24H2;1H | | InChIKey | RUQUGXBCAXQSLB-UHFFFAOYSA-N | | SMILES | NC1C(=CC2=C3C=C(N)C(N)=CC3=C3C=C(N)C(N)=CC3=C2C=1)N.Cl |
| | 2,3,6,7,10,11-hexaaminotriphenylene Usage And Synthesis |
| Description | 2,3,6,7,10,11-hexaaminotriphenylene is a yellow powder, soluble in DMSO. | | Uses | 2,3,6,7,10,11-hexaaminotriphenylene is an aromatic hydrocarbon derivative and can be used as an intermediate in organic synthesis. |
| | 2,3,6,7,10,11-hexaaminotriphenylene Preparation Products And Raw materials |
|