- Peramivir Impurity
-
-
2025-12-16
- CAS:1988779-13-0
- Min. Order: 10mg
- Purity: 95%+
- Supply Ability: 100000
|
| | Peramivir Impurity 1 Basic information |
| Product Name: | Peramivir Impurity 1 | | Synonyms: | Peramivir Impurity 1;(1S,2S,3S,4R)-3-[(1R)-1-amino-2-ethylbutyl]-4[[(1,1-dimethylethoxy)carbonyl]amino]-2- Methyl hydroxycyclovalerate;Cyclopentanecarboxylic acid, 3-[(1R)-1-amino-2-ethylbutyl]-4-[[(1,1-dimethylethoxy)carbonyl]amino]-2-hydroxy-, methyl ester, (1S,2S,3S,4R)-;methyl (1S,2S,3S,4R)-3-((R)-1-amino-2-ethylbutyl)-4-((tert-butoxycarbonyl)amino)-2- hydroxycyclopentane-1-carboxylate | | CAS: | 1988779-13-0 | | MF: | C18H34N2O5 | | MW: | 358.47 | | EINECS: | | | Product Categories: | | | Mol File: | 1988779-13-0.mol |  |
| | Peramivir Impurity 1 Chemical Properties |
| Boiling point | 476.5±45.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | pka | 11.63±0.70(Predicted) | | InChI | InChI=1S/C18H34N2O5/c1-7-10(8-2)14(19)13-12(20-17(23)25-18(3,4)5)9-11(15(13)21)16(22)24-6/h10-15,21H,7-9,19H2,1-6H3,(H,20,23)/t11-,12+,13+,14+,15+/m0/s1 | | InChIKey | SECXLAHYOAZIGA-NJVJYBDUSA-N | | SMILES | [C@H]1(C(OC)=O)C[C@@H](NC(OC(C)(C)C)=O)[C@H]([C@H](N)C(CC)CC)[C@@H]1O |
| | Peramivir Impurity 1 Usage And Synthesis |
| | Peramivir Impurity 1 Preparation Products And Raw materials |
|