| Company Name: |
Hangzhou Huarong Pharm Co., Ltd. |
| Tel: |
571-86758373 +8613588754946 |
| Email: |
sales@huarongpharm.com |
| Products Intro: |
Product Name:((R)-4-oxo-4-(3-(trifluoromethyl)-5,6-dihydro-[1,2,4]triazolo [4,3-a]pyrazin-7(8H)-yl)-1-(2,4,5-trifluorophenyl)butan-2-yl) aspartic acid CAS:2088771-60-0 Purity:0.99 Package:10MG,50MG,100MG,1G
|
|
|
|
|
|
| | Sitagliptin Impurity 21 Basic information |
| Product Name: | Sitagliptin Impurity 21 | | Synonyms: | Sitagliptin Fumarate Adduct(Sitagliptin Impurity FP-A);((R)-4-oxo-4-(3-(trifluoromethyl)-5,6-dihydro-[1,2,4]triazolo [4,3-a]pyrazin-7(8H)-yl)-1-(2,4,5-trifluorophenyl)butan-2-yl) aspartic acid;Sitagliptin Impurity FP-A;Sitagliptin impurity 5/Sitagliptin FP Impurity A/Sitagliptin Fumarate Adduct/Sitagliptin Maleate Adduct/N-[(2R)-4-Oxo-4-[3-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]aspartic acid;2-(((R)-4-oxo-4-(3-(trifluoromethyl);Sitagliptin-14;Sitagliptin FP Impurity A;L-Aspartic acid, N-[(1R)-3-[5,6-dihydro-3-(trifluoromethyl)-1,2,4-triazolo[4,3-a]pyrazin-7(8H)-yl]-3-oxo-1-[(2,4,5-trifluorophenyl)methyl]propyl]- | | CAS: | 2088771-60-0 | | MF: | C20H19F6N5O5 | | MW: | 523.39 | | EINECS: | | | Product Categories: | | | Mol File: | 2088771-60-0.mol |  |
| | Sitagliptin Impurity 21 Chemical Properties |
| Melting point | 149 - 153°C | | Boiling point | 673.9±65.0 °C(Predicted) | | density | 1.66±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 2.05±0.23(Predicted) | | form | Solid | | color | White to Off-White | | InChIKey | SDIOBAOATSWLLA-YGRLFVJLSA-N | | SMILES | C(O)(=O)[C@H](CC(O)=O)N[C@H](CC1=CC(F)=C(F)C=C1F)CC(N1CCN2C(C(F)(F)F)=NN=C2C1)=O |
| | Sitagliptin Impurity 21 Usage And Synthesis |
| Uses | Sitagliptin Fumarate Adduct is an impurity of Sitagliptin (S491000), a trizolopyrazine dipeptidyl peptidase IV inhibitor. Sitagliptin has recently been approved for the therapy of type II diabetes. |
| | Sitagliptin Impurity 21 Preparation Products And Raw materials |
|