|
|
| | Formaldehyde 2,4-dinitrophenylhydrazone Basic information |
| Product Name: | Formaldehyde 2,4-dinitrophenylhydrazone | | Synonyms: | FORMALDEHYDE-2,4-DNPH;FORMALDEHYDE (DNPH DERIVATIVE);FORMALDEHYDE-DNPH, 5X1ML, ACN 100UG/ML;FORMALDEHYDE 2,4-DINITROPHENYLHYDRAZONE, ENVIRONMENTAL STANDARD, 99%;73517, Formaldehyde 2,4-dinitrophenylhyd razone (purity);FORMALDEHYDE-DNPH, 1X1ML, ACN 100UG/ML;FORMALDEHYDE-2,4-DNPH, 100MG, NEAT;FORMALDEHYDE 2,4-DINITROPHENYLHYDRAZONE 98+% ( SEA ONLY) | | CAS: | 1081-15-8 | | MF: | C7H6N4O4 | | MW: | 210.15 | | EINECS: | 628-494-9 | | Product Categories: | Aldehyde/DNPHPassive/Diffusive Sampling;Calibration StandardsAlphabetic;California Air Resources Board (CARB) Methods;FM - FZInternational Standards;Single Component Carbonyl-DNPH Solutions;Air Monitoring Standards;Chromatography;DSD-DNPH Passive Sampling Device;F;E-F;Stains and Dyes;Stains&Dyes, A to;Alpha Sort;E-LAlphabetic;FM - FZ;Volatiles/ Semivolatiles;Air MonitoringAlphabetic;Aldehydes/DNPH;Application CRMs;Certified Reference Materials (CRMs);FM - FZChemical Class;NeatsCertified Reference Materials (CRMs);Occupational Hygiene CRM | | Mol File: | 1081-15-8.mol |  |
| | Formaldehyde 2,4-dinitrophenylhydrazone Chemical Properties |
| Melting point | 153-156°C | | Boiling point | 357.8±52.0 °C(Predicted) | | density | 1.54±0.1 g/cm3(Predicted) | | Fp | 2 °C | | storage temp. | 0-6°C | | solubility | Acetone (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 10.30±0.10(Predicted) | | color | Light Yellow to Dark Orange | | BRN | 750330 | | Stability: | Light Sensitive, Shock Sensitive | | Major Application | environmental | | InChI | InChI=1S/C7H6N4O4/c1-8-9-6-3-2-5(10(12)13)4-7(6)11(14)15/h2-4,9H,1H2 | | InChIKey | UEQLSLWCHGLSML-UHFFFAOYSA-N | | SMILES | C=NNC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O |
| Hazard Codes | Xi,Xn,F | | Risk Statements | 36/37/38-36-20/21/22-11-22 | | Safety Statements | 26-36/37/39-36-36/37-16 | | RIDADR | UN 1648 3/PG 2 | | WGK Germany | 3 | | RTECS | AB2826500 | | HS Code | 38220090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Flam. Liq. 2 |
| | Formaldehyde 2,4-dinitrophenylhydrazone Usage And Synthesis |
| Uses | Formaldehyde 2,4-Dinitrophenylhydrazone is a dinitrophenylhydrazone (DNPH) derivative of an aliphatic aldehyde found in mainstream cigarette smoke. |
| | Formaldehyde 2,4-dinitrophenylhydrazone Preparation Products And Raw materials |
|