|
|
| | N1,N2-bis(thiophen-2-ylmethyl)oxalamide Basic information |
| Product Name: | N1,N2-bis(thiophen-2-ylmethyl)oxalamide | | Synonyms: | N1,N2-bis(thiophen-2-ylmethyl)oxalamide;Ethanediamide, N1,N2-bis(2-thienylmethyl)-;N1,?N2-?bis(2-?thienylmethyl)?- Ethanediamide;N1,N2-Bis(2-thienylmethyl)oxalamide;N1,N2-bis(2-thiophenemethyl)-ethyldiamide;N,N'-Bis(2-thienylmethyl)ethanediamide | | CAS: | 920366-91-2 | | MF: | C12H12N2O2S2 | | MW: | 280.37 | | EINECS: | | | Product Categories: | | | Mol File: | 920366-91-2.mol |  |
| | N1,N2-bis(thiophen-2-ylmethyl)oxalamide Chemical Properties |
| density | 1.355±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 11.47±0.46(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C12H12N2O2S2/c15-11(13-7-9-3-1-5-17-9)12(16)14-8-10-4-2-6-18-10/h1-6H,7-8H2,(H,13,15)(H,14,16) | | InChIKey | NOSYGNWELJYIQH-UHFFFAOYSA-N | | SMILES | C(NCC1SC=CC=1)(=O)C(NCC1SC=CC=1)=O |
| | N1,N2-bis(thiophen-2-ylmethyl)oxalamide Usage And Synthesis |
| | N1,N2-bis(thiophen-2-ylmethyl)oxalamide Preparation Products And Raw materials |
|