|
|
| | 1-N-Boc-3-(N-methyl-aminomethyl)piperidine Basic information |
| Product Name: | 1-N-Boc-3-(N-methyl-aminomethyl)piperidine | | Synonyms: | tert-butyl 3-((MethylaMino)Methyl)piperidin-1-carboxylate;3-[(Methylamino)methyl]-1-piperidinecarboxylic acid tert-butyl ester;1-Boc-3-[(MethylaMino)Methyl]piperidine;ert-Butyl 3-[(methylamino)methyl]piperidine-1-carboxylate;1-Boc-3-((Methylamino);OTAVA-BB 1037918;TERT-BUTYL 3-[(METHYLAMINO)METHYL]-1-PIPERIDINECARBOXYLATE;1-piperidinecarboxylic acid, 3-[(methylamino)methyl]-, 1,1 | | CAS: | 1017356-25-0 | | MF: | C12H24N2O2 | | MW: | 228.33 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 1-N-Boc-3-(N-methyl-aminomethyl)piperidine Chemical Properties |
| Boiling point | 301.0±15.0 °C(Predicted) | | density | 0.988 | | storage temp. | 2-8°C | | form | solid | | pka | 10.40±0.10(Predicted) | | Appearance | Colorless to off-white Solid-Liquid Mixture | | InChI | 1S/C12H24N2O2/c1-12(2,3)16-11(15)14-7-5-6-10(9-14)8-13-4/h10,13H,5-9H2,1-4H3 | | InChIKey | FWYMKDGOQBTQNE-UHFFFAOYSA-N | | SMILES | O=C(OC(C)(C)C)N(CCC1)CC1CNC |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | 2810 | | WGK Germany | 3 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1-N-Boc-3-(N-methyl-aminomethyl)piperidine Usage And Synthesis |
| | 1-N-Boc-3-(N-methyl-aminomethyl)piperidine Preparation Products And Raw materials |
|