| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | AMMONIUM-15N NITRATE Basic information |
| | AMMONIUM-15N NITRATE Chemical Properties |
| Melting point | 169 °C(lit.) | | Boiling point | 201 °C(lit.) | | form | solid | | InChI | InChI=1S/HNO3.H3N/c2-1(3)4;/h(H,2,3,4);1H3/i;1+1 | | InChIKey | PRORZGWHZXZQMV-IEOVAKBOSA-N | | SMILES | [N+]([O-])(=O)O.[15NH3] | | CAS Number Unlabeled | 6484-52-2 |
| Hazard Codes | O,Xi | | Risk Statements | 8-36/37/38 | | Safety Statements | 15-17-26-36 | | RIDADR | UN 1942 5.1/PG 3 | | WGK Germany | 3 | | F | 3-10 | | HS Code | 28459000 | | Storage Class | 5.1C - Ammonium nitrate and ammonium nitrate containing preparations | | Hazard Classifications | Eye Irrit. 2 Ox. Sol. 3 |
| | AMMONIUM-15N NITRATE Usage And Synthesis |
| Chemical Properties | White crystalline | | Uses | agriculture |
| | AMMONIUM-15N NITRATE Preparation Products And Raw materials |
|