| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Toluene-13C6 Basic information |
| Product Name: | Toluene-13C6 | | Synonyms: | Methyl(benzene-13C6);Toluene-13C6 (phenyl-13C6);Toluene-(phenyl-13C6)
;[U-Ring-13C6]-Toluene;13C6]-Toluene;Ring-13C6]-TOLUENE(99%);Toluene-(phenyl-13C6);ring-13C6-Toluene | | CAS: | 287399-35-3 | | MF: | C7H8 | | MW: | 98.19 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Toluene-13C6 Chemical Properties |
| Melting point | -93 °C(lit.) | | Boiling point | 110 °C(lit.) | | density | 0.920 g/mL at 25 °C | | solubility | soluble in DMSO | | form | Liquid | | color | Colourless | | Stability: | Volatile | | InChI | 1S/C7H8/c1-7-5-3-2-4-6-7/h2-6H,1H3/i2+1,3+1,4+1,5+1,6+1,7+1 | | InChIKey | YXFVVABEGXRONW-WBJZHHNVSA-N | | SMILES | C[13c]1[13cH][13cH][13cH][13cH][13cH]1 | | CAS Number Unlabeled | 108-88-3 |
| Hazard Codes | F,Xn | | Risk Statements | 11-38-48/20-63-65-67 | | Safety Statements | 36/37-46-62 | | RIDADR | UN 1294 3/PG 2 | | WGK Germany | WGK 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Chronic 3
Asp. Tox. 1
Flam. Liq. 2
Repr. 2
Skin Irrit. 2
STOT RE 2 Inhalation
STOT SE 3 |
| | Toluene-13C6 Usage And Synthesis |
| Uses | Isotope labelled toluene (T535870) is an aromatic hydrocarbon and the mono-substituted derivative of benzene. Toluene is widely used in industry as an building block for pharmaceutical goods and as well as an organic solvent in synthetic preparations. Toluene can also be used as an octane booster in gasoline fuels in internal combustion engines and as jet fuel surrogate. |
| | Toluene-13C6 Preparation Products And Raw materials |
|