| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5-(4-HYDROXYPHENYL)-5-PHENYLHYDANTOIN Basic information |
| | 5-(4-HYDROXYPHENYL)-5-PHENYLHYDANTOIN Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 411.43°C (rough estimate) | | density | 1.1992 (rough estimate) | | refractive index | 1.5906 (estimate) | | solubility | soluble50mg/mL, clear, colorless to faintly yellow (DMF:MeOH(2:1)) | | form | Solid | | pka | 8.37±0.10(Predicted) | | color | White to Off-White | | Water Solubility | 36mg/L(37 ºC) | | InChI | 1S/C15H12N2O3/c18-12-8-6-11(7-9-12)15(10-4-2-1-3-5-10)13(19)16-14(20)17-15/h1-9,18H,(H2,16,17,19,20) | | InChIKey | XEEDURHPFVXALT-UHFFFAOYSA-N | | SMILES | Oc1ccc(cc1)C2(NC(=O)NC2=O)c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | MU2485000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-(4-HYDROXYPHENYL)-5-PHENYLHYDANTOIN Usage And Synthesis |
| Uses | 5-(4-Hydroxyphenyl)-5-phenylhydantoin was used in enantiomeric separation of chiral pharmaceuticals using a teicoplanin chiral stationary phase by aqueous and non-aqueous packed capillary electrochromatography. It was used as internal standard in determination of phenylbutazone and its metabolite oxyphenbutazone in human plasma by GLC. | | Definition | ChEBI: A imidazolidine-2,4-dione that consists of hydantoin bearing phenyl and 4-hydroxyphenyl substituents at position 5. | | General Description | 5-(4-Hydroxyphenyl)-5-phenylhydantoin is the major metabolite of phenytoin. |
| | 5-(4-HYDROXYPHENYL)-5-PHENYLHYDANTOIN Preparation Products And Raw materials |
|