|
|
| | COBALT(II) SULFATE HYDRATE Basic information |
| Product Name: | COBALT(II) SULFATE HYDRATE | | Synonyms: | COBALT(II) SULFATE;COBALT(II) SULFATE HYDRATE;COBALTOUS SULFATE HYDRATE;COBALTOUS SULFATE MONOHYDRATE;COBALT SULFATE HYDRATE;COBALT SULFATE MONOHYDRATE;Cobalt(Ⅱ) sulfate anhydrous;Cobalt(II) sulfate hydrate, 99.998% metals basis | | CAS: | 60459-08-7 | | MF: | CoH2O5S | | MW: | 173.01 | | EINECS: | 628-130-9 | | Product Categories: | | | Mol File: | 60459-08-7.mol |  |
| | COBALT(II) SULFATE HYDRATE Chemical Properties |
| density | 2.03 g/mL at 25 °C(lit.) | | form | Crystalline Powder | | color | Red-orange | | Water Solubility | Soluble in water. Slightly soluble in methanol and ethanol | | Exposure limits | ACGIH: TWA 0.02 mg/m3 | | Major Application | battery precursors catalysts material synthesis precursor | | InChI | 1S/Co.H2O4S.H2O/c;1-5(2,3)4;/h;(H2,1,2,3,4);1H2/q+2;;/p-2 | | InChIKey | BGORGFZEVHFAQU-UHFFFAOYSA-L | | SMILES | O.[Co++].[O-]S([O-])(=O)=O | | CAS DataBase Reference | 60459-08-7(CAS DataBase Reference) |
| Hazard Codes | T,N | | Risk Statements | 49-22-42/43-50/53-68-60 | | Safety Statements | 53-22-45-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | RTECS | GG3200000 | | TSCA | Yes | | HazardClass | 9 | | PackingGroup | III | | HS Code | 28332930 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Inhalation Muta. 2 Repr. 1B Resp. Sens. 1 Skin Sens. 1 |
| | COBALT(II) SULFATE HYDRATE Usage And Synthesis |
| Chemical Properties | Reddish crystalline powder | | Uses | Ceramics, pigments, glazes, plating baths, catalyst, storage batteries, paint/ink drier | | Uses | Cobalt(II) sulfate hydrate (CoSO4.H2O) can be used in the synthesis of coordination polymers. It can also be used as a starting material in the synthesis of cobalt sulfides hexagonal nanocrystallites. | | Purification Methods | Crystallise it three times from conductivity water (1.3mL/g) between 100o and 0o depending on which hydrate is required. The heptahydrate crystallises below 44o and is efflorescent with m 97o . Between 44o and 70o the monoclinic hexahydrate CoSO4.6H2O m 41.5o is formed, and above 70o the monohydrate CoSO4.H2O m 71o is obtained. The pale reddish or lavender-coloured anhydrous salt is obtained by heating the hydrate above 250o, boiling with conc H2SO4 or heating with (NH4)2SO4). |
| | COBALT(II) SULFATE HYDRATE Preparation Products And Raw materials |
|