| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | trans-2-Phenylcyclopropyl isocyanate Basic information |
| | trans-2-Phenylcyclopropyl isocyanate Chemical Properties |
| Boiling point | 75-76 °C0.5 mm Hg(lit.) | | density | 1.074 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.546(lit.) | | Fp | 225 °F | | form | liquid | | InChI | 1S/C10H9NO/c12-7-11-10-6-9(10)8-4-2-1-3-5-8/h1-5,9-10H,6H2/t9-,10+/m0/s1 | | InChIKey | DYUXVJAFBUZREW-VHSXEESVSA-N | | SMILES | O=C=N[C@@H]1C[C@H]1c2ccccc2 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 23-26-28-37/39 | | RIDADR | UN 2206 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Resp. Sens. 1
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | trans-2-Phenylcyclopropyl isocyanate Usage And Synthesis |
| Uses | trans-2-Phenylcyclopropyl isocyanate was used as isocyante monomer during general solid-phase synthesis for identification of peroxisome proliferator-activated receptor ligands. |
| | trans-2-Phenylcyclopropyl isocyanate Preparation Products And Raw materials |
|