| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | H-D-Ala-Leu-Lys-AMC Basic information |
| | H-D-Ala-Leu-Lys-AMC Chemical Properties |
| Boiling point | 808.0±65.0 °C(Predicted) | | density | 1.208±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | water: 1 mg/mL, clear, colorless | | pka | 12.53±0.20(Predicted) | | form | powder | | Water Solubility | water: 1mg/mL, clear, colorless | | InChIKey | FHYIXLQAMONDNN-UHFFFAOYSA-N | | SMILES | CC(C)CC(NC(=O)C(C)N)C(=O)NC(CCCCN)C(=O)Nc1ccc2C(C)=CC(=O)Oc2c1 |
| Safety Statements | 22-24/25 | | WGK Germany | - | | Storage Class | 11 - Combustible Solids |
| | H-D-Ala-Leu-Lys-AMC Usage And Synthesis |
| Uses | H-D-Ala-Leu-Lys-AMC Hydrochloride Salt (CAS# 2415727-86-3) is a fluorogenic substrate for IRCM-serine protease 1, purified from porcine neuro intermediate and anterior pituitary lobes (1). |
| | H-D-Ala-Leu-Lys-AMC Preparation Products And Raw materials |
|