| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Decanoic acid 4-nitrophenyl ester Basic information |
| Product Name: | Decanoic acid 4-nitrophenyl ester | | Synonyms: | P-NITROPHENYL CAPRATE;4-Nitrophenyl caprate, Decanoic acid 4-nitrophenyl ester;N-[2-[4-[ethyl-[3-(isopropylamino)-2-pyridyl]amino]piperidine-1-carbonyl]-1H-indol-5-yl]methanesulfonamide;N-[2-[4-[ethyl-[3-(propan-2-ylamino)pyridin-2-yl]amino]piperidin-1-yl]carbonyl-1H-indol-5-yl]methanesulfonamide;N-[2-[4-[ethyl-[3-(propan-2-ylamino)pyridin-2-yl]amino]piperidine-1-carbonyl]-1H-indol-5-yl]methanesulfonamide;4-Nitrophenyl decanoate,4-Nitrophenyl caprate, Decanoic acid 4-nitrophenyl ester;4-NITROPHENYL CAPRATE;4-NITROPHENYL DECANOATE | | CAS: | 1956-09-8 | | MF: | C16H23NO4 | | MW: | 293.36 | | EINECS: | | | Product Categories: | | | Mol File: | 1956-09-8.mol |  |
| | Decanoic acid 4-nitrophenyl ester Chemical Properties |
| Melting point | ~35 °C | | storage temp. | -20°C | | solubility | chloroform: soluble 100mg/mL, colorless to faintly yellow | | form | powder | | BRN | 1915230 | | InChI | 1S/C16H23NO4/c1-2-3-4-5-6-7-8-9-16(18)21-15-12-10-14(11-13-15)17(19)20/h10-13H,2-9H2,1H3 | | InChIKey | RRNKCSIEGPOIKI-UHFFFAOYSA-N | | SMILES | CCCCCCCCCC(=O)Oc1ccc(cc1)[N+]([O-])=O |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36/37 | | WGK Germany | 3 | | F | 8-10-21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | Decanoic acid 4-nitrophenyl ester Usage And Synthesis |
| Uses | 4-Nitrophenyl decanoate has been used as a substrate to assess the carboxylesterase production by recombinant Penicillium griseoroseum T55 strain. It has also been used for general esterase activity assay of the hepatopancreas extract. | | Biochem/physiol Actions | 4-Nitrophenyl decanoate is a substrate for lipase enzyme. The extracellular lipase has greater hydrolysis reaction velocity with 4-nitrophenyl decanoate when compared with other 4-nitropheny esters. |
| | Decanoic acid 4-nitrophenyl ester Preparation Products And Raw materials |
|