|
|
| | Triphenylphosphine selenide Basic information |
| | Triphenylphosphine selenide Chemical Properties |
| Melting point | 186-188 °C | | Boiling point | 448.6±28.0 °C(Predicted) | | storage temp. | Store below +30°C. | | solubility | very sol dichloromethane; moderately sol on heating in acetonitrile, benzene, 1-butanol, ethanol, methanol; insol ether, water | | form | solid | | color | White to Almost white | | InChI | 1S/C18H15PSe/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H | | InChIKey | ZFVJLNKVUKIPPI-UHFFFAOYSA-N | | SMILES | [Se-][P+](c3ccccc3)(c2ccccc2)c1ccccc1 |
| Hazard Codes | T,N | | Risk Statements | 23/25-33-50/53 | | Safety Statements | 20/21-28-45-60-61 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | RTECS | SZ2455000 | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29310099 | | Storage Class | 6.1C - Combustible, acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 | | Toxicity | rat,LD,oral,> 500mg/kg (500mg/kg),National Academy of Sciences, National Research Council, Chemical-Biological Coordination Center, Review. Vol. 5, Pg. 39, 1953. |
| | Triphenylphosphine selenide Usage And Synthesis |
| Chemical Properties | WHITE TO OFF-WHITE CRYSTALLINE POWDER | | Uses |
Triphenylphosphine Selenide is used for conversion of epoxides into alkenes.
| | Preparation |
Triphenylphosphine Selenide is prepared from Triphenylphosphine and either Potassium Selenocyanate or elemental Selenium.
| | Purification Methods | Triphenylphosphine Selenide is purified by recrystallization from ethanol.
| | Precautions |
Triphenylphosphine Selenide is toxic; use in a fume hood.
|
| | Triphenylphosphine selenide Preparation Products And Raw materials |
|