| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | tert-butyl 4-(4-nitrophenoxy)piperidine-1-carboxylate Basic information |
| Product Name: | tert-butyl 4-(4-nitrophenoxy)piperidine-1-carboxylate | | Synonyms: | TERT-BUTYL 4-(4-NITROPHENOXY)PIPERIDINE-1-CARBOXYLATE;TERT-BUTYL 4-(4-NITROPHENOXY)TETRAHYDRO-1(2H)-PYRIDINECARBOXYLATE;BUTTPARK 99\57-88;1N-BOC 4-(4'-NITROPHENOXY) PIPERIDINE;4-(4-NITROPHENOXY)PIPERIDINE, N-BOC PROTECTED;1N-Boc 4-(4'-nitrophenyl) piperidine;4-(4-Nitrophenoxy)piperidine, N-BOC protected 97%;1-Boc-4-(4'-Nitrophenoxy)piperidine | | CAS: | 138227-62-0 | | MF: | C16H22N2O5 | | MW: | 322.36 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 138227-62-0.mol |  |
| | tert-butyl 4-(4-nitrophenoxy)piperidine-1-carboxylate Chemical Properties |
| Melting point | 99 °C | | Boiling point | 453.7±35.0 °C(Predicted) | | density | 1.211±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -2.77±0.40(Predicted) | | InChI | InChI=1S/C16H22N2O5/c1-16(2,3)23-15(19)17-10-8-14(9-11-17)22-13-6-4-12(5-7-13)18(20)21/h4-7,14H,8-11H2,1-3H3 | | InChIKey | UNNMTKGKCWNQNU-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(OC2=CC=C([N+]([O-])=O)C=C2)CC1 |
| Hazard Codes | Xi | | Hazard Note | Irritant |
| | tert-butyl 4-(4-nitrophenoxy)piperidine-1-carboxylate Usage And Synthesis |
| | tert-butyl 4-(4-nitrophenoxy)piperidine-1-carboxylate Preparation Products And Raw materials |
|