|
|
| | 9-(4'-chloro-[1,1'-biphenyl]-2-yl)-9H-carbazole Basic information |
| Product Name: | 9-(4'-chloro-[1,1'-biphenyl]-2-yl)-9H-carbazole | | Synonyms: | 9-(4'-chloro-[1,1'-biphenyl]-2-yl)-9H-carbazole;9-(4'-chlorobiphenyl-2-yl)-9H-carbazole;9H-Carbazole, 9-(4'-chloro[1,1'-biphenyl]-2-yl)-;Pentamethylcyclopentadienylrhodium(II)chloride dimer;N-(4'-Chlorobiphenyl-2-yl)carbazole | | CAS: | 2098811-14-2 | | MF: | C24H16ClN | | MW: | 353.84 | | EINECS: | | | Product Categories: | | | Mol File: | 2098811-14-2.mol | ![9-(4'-chloro-[1,1'-biphenyl]-2-yl)-9H-carbazole Structure](CAS/20180703/GIF/CB53959544.gif) |
| | 9-(4'-chloro-[1,1'-biphenyl]-2-yl)-9H-carbazole Chemical Properties |
| Boiling point | 546.2±42.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | InChI | InChI=1S/C24H16ClN/c25-18-15-13-17(14-16-18)19-7-1-4-10-22(19)26-23-11-5-2-8-20(23)21-9-3-6-12-24(21)26/h1-16H | | InChIKey | FHMUKVVBOGEZFI-UHFFFAOYSA-N | | SMILES | N1(C2=CC=CC=C2C2=CC=C(Cl)C=C2)C2=C(C=CC=C2)C2=C1C=CC=C2 |
| | 9-(4'-chloro-[1,1'-biphenyl]-2-yl)-9H-carbazole Usage And Synthesis |
| Uses | 9-(4'-chloro-[1,1'-biphenyl]-2-yl)-9H-carbazole is a heterocyclic organic compound and can be used as an intermediate for synthetic materials. |
| | 9-(4'-chloro-[1,1'-biphenyl]-2-yl)-9H-carbazole Preparation Products And Raw materials |
|