|
|
| | 3,3'-DIMETHOXYBENZIL Basic information |
| Product Name: | 3,3'-DIMETHOXYBENZIL | | Synonyms: | 1,2-Bis(3-methoxyphenyl)-1,2-ethanedione;1,2-Bis-(3-methoxy-phenyl)-ethan-1,2-dion;1,2-Bis-(3-methoxy-phenyl)-ethan-1,2-dione;Ethanedione, bis(3-methoxyphenyl)-;3,3-Dimethoxydibenzoyl;bis(3-methoxyphenyl)ethanedione;3,3''-DIMETHOXYBENZIL, 99+%;3,3'-Dimethoxybibenzyl-α,β-dione | | CAS: | 40101-17-5 | | MF: | C16H14O4 | | MW: | 270.28 | | EINECS: | 254-793-5 | | Product Categories: | C15 to C38;Carbonyl Compounds;Ketones | | Mol File: | 40101-17-5.mol |  |
| | 3,3'-DIMETHOXYBENZIL Chemical Properties |
| Melting point | 82-84 °C(lit.) | | Boiling point | 442.2±30.0 °C(Predicted) | | density | 1.183±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | Off-white to light yellow Solid | | Water Solubility | Insoluble in water. | | BRN | 2382124 | | InChI | 1S/C16H14O4/c1-19-13-7-3-5-11(9-13)15(17)16(18)12-6-4-8-14(10-12)20-2/h3-10H,1-2H3 | | InChIKey | PJGXOGKIVAJFTE-UHFFFAOYSA-N | | SMILES | COc1cccc(c1)C(=O)C(=O)c2cccc(OC)c2 | | EPA Substance Registry System | Ethanedione, bis(3-methoxyphenyl)- (40101-17-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3,3'-DIMETHOXYBENZIL Usage And Synthesis |
| Uses | 3,3'-Dimethoxybenzil used in the preparation of benzil derivatives. It is also used as an intermediate in organic synthesis and pharmaceuticals. | | General Description | 3,3′-Dimethoxybenzil is a benzyl derivative. Modelling of the structured thermal diffuse scattering from 3,3′-dimethoxybenzil has been reported. |
| | 3,3'-DIMETHOXYBENZIL Preparation Products And Raw materials |
|