| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2-Methylallylamine manufacturers
- 2-Methylallylamine
-
-
2026-06-30
- CAS:2878-14-0
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
- 2-Methylallylamine
-
- $1.00
-
2020-01-09
- CAS:2878-14-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
|
| | 2-Methylallylamine Basic information |
| Product Name: | 2-Methylallylamine | | Synonyms: | 2-METHYLALLYLAMINE;CH2=C(CH3)CH2NH2;METHALLYLAMINE;2-Methylallylamine 98%;2-METHYL-2-PROPEN-1-AMINE;3-(METHYLAMINO)-1-PROPEN;AKOS 91389;2-Methyl allyl aMine HCl | | CAS: | 2878-14-0 | | MF: | C4H9N | | MW: | 71.12 | | EINECS: | 220-724-2 | | Product Categories: | | | Mol File: | 2878-14-0.mol |  |
| | 2-Methylallylamine Chemical Properties |
| Boiling point | 78 °C | | density | 0.78 | | refractive index | 1.429-1.432 | | Fp | -28 °C | | storage temp. | 0-6°C | | form | Liquid | | pka | 9.45±0.29(Predicted) | | color | Clear colorless | | InChI | InChI=1S/C4H9N/c1-4(2)3-5/h1,3,5H2,2H3 | | InChIKey | VXDHQYLFEYUMFY-UHFFFAOYSA-N | | SMILES | C(N)C(C)=C | | NIST Chemistry Reference | 2-Propen-1-amine, 2-methyl-(2878-14-0) |
| Hazard Codes | Xi-F,F,Xi,C,Xn | | Risk Statements | 36/37/38-11-36-22 | | Safety Statements | 37/39-26-16 | | RIDADR | 1992 | | WGK Germany | 3 | | Hazard Note | Highly Flammable/Irritant | | HazardClass | FLAMMABLE, CORROSIVE | | PackingGroup | II | | HS Code | 29211990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| Provider | Language |
|
ACROS
| English |
| | 2-Methylallylamine Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | 2-Methylallylamine is an intermediate used in the synthesis of urea-containing FK506 binding protein inhibitors. It is also used to prepare benzothiazepine dioxides with HIV-1 protease inhibitory activities. It is dehydrogenated to methacrylonitrile over a silver catalyst. Copolymerization of methallylamine with acrylonitrile increases the affinity of polyacrylonitrile fibers for dyes. |
| | 2-Methylallylamine Preparation Products And Raw materials |
|