| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | [1-13Cglc]Lactose Monohydrate Basic information |
| | [1-13Cglc]Lactose Monohydrate Chemical Properties |
| Melting point | 219 °C (dec.) (lit.) | | form | powder | | Optical Rotation | [α]25/D +52.0°, c =2 in H2O (trace NH4OH) | | InChI | 1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11,12+/m1/s1/i11+1 | | InChIKey | GUBGYTABKSRVRQ-OUDYAVHASA-N | | SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[13C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | [1-13Cglc]Lactose Monohydrate Usage And Synthesis |
| Uses | [1-13Cglc]Lactose Monohydrate, which is used in the synthesis of casing for various methods of oral drug delivery, including dissolving pellets, and long-lasting pellets. | | Uses | Labelled Lactose Monohydrate (L114000), which is used in the synthesis of casing for various methods of oral drug delivery, including dissolving pellets, and long-lasting pellets. |
| | [1-13Cglc]Lactose Monohydrate Preparation Products And Raw materials |
|