| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-(4-Methoxyphenethyl)-4-aminopiperidine Basic information |
| Product Name: | 1-(4-Methoxyphenethyl)-4-aminopiperidine | | Synonyms: | 1-[2-(4-METHOXYPHENYL)ETHYL]-4-AMINOPIPERIDINE;4-AMINO-1-[2-(4-METHOXYPHENYL)ETHYL]PIPERIDINE;4-AMINO-1-(4-METHOXYPHENETHYL)PIPERIDINE;1-[2-(4-methoxyphenyl)ethyl]piperidin-4-amine;1-[2-(4-Methoxyphenyl)ethyl]-4-piperidinamine;Einecs 285-422-5;1-[2-(4-Methoxyphenyl)ethyl]-4-piperidinylamine;1-(4-methoxyphenethyl)piperidin-4-amine | | CAS: | 85098-70-0 | | MF: | C14H22N2O | | MW: | 234.34 | | EINECS: | 285-422-5 | | Product Categories: | | | Mol File: | 85098-70-0.mol |  |
| | 1-(4-Methoxyphenethyl)-4-aminopiperidine Chemical Properties |
| Melting point | 30-32 °C | | Boiling point | 346.6±37.0 °C(Predicted) | | density | 1.030±0.06 g/cm3(Predicted) | | form | powder to crystal | | pka | 10.49±0.20(Predicted) | | color | White to Yellow to Orange | | InChI | 1S/C14H22N2O/c1-17-14-4-2-12(3-5-14)6-9-16-10-7-13(15)8-11-16/h2-5,13H,6-11,15H2,1H3 | | InChIKey | HTGMIBQQTLUEKV-UHFFFAOYSA-N | | SMILES | COc1ccc(CCN2CCC(N)CC2)cc1 |
| WGK Germany | WGK 3 | | HS Code | 2933.39.9200 | | Storage Class | 11 - Combustible Solids |
| | 1-(4-Methoxyphenethyl)-4-aminopiperidine Usage And Synthesis |
| | 1-(4-Methoxyphenethyl)-4-aminopiperidine Preparation Products And Raw materials |
|