|
|
| | 3,9-Bis(1,1-dimethyl-2-hydroxyethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane Basic information | | Uses |
| Product Name: | 3,9-Bis(1,1-dimethyl-2-hydroxyethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane | | Synonyms: | 2,2'-(2,4,8,10-TETRAOXASPIRO[ 5.5] UNDECANE-3,9-DIYL)BIS(2,2-DIMETHYLETHANOL);BIS(HYDROXYPIVALALDEHYDE) PENTAERYTHRITOLACETAL CYCLIC ACETAL;SPIROGLYCOL;2,2-Dimethyl-3-hydroxypropionaldehyde pentaerythrityl bisacetal;3 9-BIS(1,1-DIMETHYL-2-HYDROXYETHYL)-2,4,8,10-TETRAOXASPIRO [5.5]UNDECANE 97+%;3,9-BIS(1,1-DIMETHYL-2-HYDROXYETHYL)-2,4,8,10-TETRAOXASPIRO[;3,9-Bis(1,1-dimethyl-2-hydroxyethyl)-2,4,8,10-tetraoxaspiro5.5üundecane, 97%;3,9-Bis(2-hydroxy-1,1-dimethylethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane | | CAS: | 1455-42-1 | | MF: | C15H28O6 | | MW: | 304.38 | | EINECS: | 485-230-3 | | Product Categories: | Dioxanes;Dioxanes & Dioxolanes | | Mol File: | 1455-42-1.mol | ![3,9-Bis(1,1-dimethyl-2-hydroxyethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane Structure](CAS/GIF/1455-42-1.gif) |
| | 3,9-Bis(1,1-dimethyl-2-hydroxyethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane Chemical Properties |
| Melting point | 198-200°C | | Boiling point | 434.2±40.0 °C(Predicted) | | density | 1.16 | | vapor pressure | 0Pa at 25℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | almost transparency in hot Methanol | | pka | 14.38±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Water Solubility | 168mg/L at 20℃ | | BRN | 1574570 | | InChI | InChI=1S/C15H28O6/c1-13(2,5-16)11-18-7-15(8-19-11)9-20-12(21-10-15)14(3,4)6-17/h11-12,16-17H,5-10H2,1-4H3 | | InChIKey | BPZIYBJCZRUDEG-UHFFFAOYSA-N | | SMILES | C12(COC(C(C)(C)CO)OC1)COC(C(C)(C)CO)OC2 | | LogP | 1.63 at 30℃ | | EPA Substance Registry System | 2,4,8,10-Tetraoxaspiro[5.5]undecane-3,9-diethanol, .beta.,.beta.,.beta.',.beta.'-tetramethyl- (1455-42-1) |
| Safety Statements | 22-24/25 | | TSCA | TSCA listed | | HS Code | 29329990 |
| Provider | Language |
|
ALFA
| English |
| | 3,9-Bis(1,1-dimethyl-2-hydroxyethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane Usage And Synthesis |
| Uses | 3,9-BIS(1,1-DIMETHYL-2-HYDROXYETHYL)-2,4,8,10-TETRAOXASPIRO[5.5]UNDECANE is an important fine chemical intermediate, often used as a monomer in the production of polymer materials such as polycarbonate, ethoxy resin, polyurethane, polyether polyol and epoxy resin. It can also be used as a raw material for adhesives, plasticizers, resin stabilizers, lubricants and so on. | | Chemical Properties | White powder | | Flammability and Explosibility | Non flammable |
| | 3,9-Bis(1,1-dimethyl-2-hydroxyethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane Preparation Products And Raw materials |
|