| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | 3-(4-Chlorophenyl)-1-methyl-1H-pyrazole-5-carboxylic acid Basic information |
| Product Name: | 3-(4-Chlorophenyl)-1-methyl-1H-pyrazole-5-carboxylic acid | | Synonyms: | 5-(4-Chloro-phenyl)-2-methyl-2H-pyrazole-3-carboxylic acid;1H-Pyrazole-5-carboxylic acid, 3-(4-chlorophenyl)-1-methyl-;3-(4-chlorophenyl)-1-methyl-1H-pyridineazole-5-carboxylic acid;3-(4-Chlorophenyl)-1-methyl-1H-pyrazole-5-carboxylic acid | | CAS: | 1015868-48-0 | | MF: | C11H9ClN2O2 | | MW: | 236.65 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 3-(4-Chlorophenyl)-1-methyl-1H-pyrazole-5-carboxylic acid Chemical Properties |
| Boiling point | 443.7±35.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 2.87±0.25(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C11H9ClN2O2/c1-14-10(11(15)16)6-9(13-14)7-2-4-8(12)5-3-7/h2-6H,1H3,(H,15,16) | | InChIKey | JNOADCITUCNMIN-UHFFFAOYSA-N | | SMILES | Cn1nc(cc1C(O)=O)-c2ccc(Cl)cc2 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-(4-Chlorophenyl)-1-methyl-1H-pyrazole-5-carboxylic acid Usage And Synthesis |
| | 3-(4-Chlorophenyl)-1-methyl-1H-pyrazole-5-carboxylic acid Preparation Products And Raw materials |
|