|
|
| | 1-Methyl-3-phenyl-1H-pyrazole-5-carboxylic acid Basic information |
| Product Name: | 1-Methyl-3-phenyl-1H-pyrazole-5-carboxylic acid | | Synonyms: | 1-methyl-3-phenyl-1H-pyrazole-5-carboxylic acid(SALTDATA: FREE);5-Carboxy-1-methyl-3-phenyl-1H-pyrazole;1H-Pyrazole-5-carboxylic acid, 1-methyl-3-phenyl-;1-Methyl-3-phenyl-1H-pyrazole-5-carboxylic acid 97%;2-Methyl-5-phenyl-2H-pyrazole-3-carboxylic acid;1-Methyl-3-phenyl-1H-pyrazole-5-carboxylic acid 95+%;2-methyl-5-phenyl-pyrazole-3-carboxylic acid;1-Methyl-3-phenyl-1H-pyrazole-5-carboxylic acid | | CAS: | 10250-64-3 | | MF: | C11H10N2O2 | | MW: | 202.21 | | EINECS: | | | Product Categories: | | | Mol File: | 10250-64-3.mol |  |
| | 1-Methyl-3-phenyl-1H-pyrazole-5-carboxylic acid Chemical Properties |
| Melting point | 186 °C | | Boiling point | 419.6±33.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 2.97±0.25(Predicted) | | color | White | | InChI | 1S/C11H10N2O2/c1-13-10(11(14)15)7-9(12-13)8-5-3-2-4-6-8/h2-7H,1H3,(H,14,15) | | InChIKey | RTBQZMPYPFQBHA-UHFFFAOYSA-N | | SMILES | Cn1nc(cc1C(O)=O)-c2ccccc2 | | CAS DataBase Reference | 10250-64-3 |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | WGK Germany | 3 | | HS Code | 2933199090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 1-Methyl-3-phenyl-1H-pyrazole-5-carboxylic acid Usage And Synthesis |
| Synthesis | The general procedure for the synthesis of 1-methyl-3-phenyl-1H-pyrazole-5-carboxylic acid from methyl 1-methyl-3-phenyl-1H-pyrazole-5-carboxylate was as follows: 1-methyl-3-phenyl-1H-pyrazole-5-carboxylic acid methyl ester (1.00 g, 6.23 mmol) was dissolved in a mixed solvent of ethanol (10 mL) and water (10 mL), and then lithium hydroxide mono hydrate (0.582 g, 13.87 mmol). The reaction mixture was stirred at 50 °C until the reaction was complete as monitored by high performance liquid chromatography (HPLC). After completion of the reaction, the mixture was concentrated to dryness and the residue was dissolved in water and extracted with dichloromethane (DCM). The aqueous phase was acidified with 1N hydrochloric acid to pH < 3. The precipitated solid was collected by filtration and dried under high vacuum to afford 1-methyl-3-phenyl-1H-pyrazole-5-carboxylic acid (0.887 g, 95% yield) as a white solid. The mass spectrum (APCI positive ion mode) showed m/z 203 (100%) ([M+H]+). | | References | [1] Patent: WO2008/11131, 2008, A2. Location in patent: Page/Page column 260 [2] Chemische Berichte, 1933, vol. 66, p. 1690,1692 [3] Patent: EP1176140, 2002, A1. Location in patent: Page 49 - 50 |
| | 1-Methyl-3-phenyl-1H-pyrazole-5-carboxylic acid Preparation Products And Raw materials |
|