|
|
| | 1-Boc-4-(2-formylphenyl)piperazine Basic information |
| | 1-Boc-4-(2-formylphenyl)piperazine Chemical Properties |
| Melting point | 86-90 °C(lit.) | | Boiling point | 425.3±40.0 °C(Predicted) | | density | 1.154±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 2.48±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | 1S/C16H22N2O3/c1-16(2,3)21-15(20)18-10-8-17(9-11-18)14-7-5-4-6-13(14)12-19/h4-7,12H,8-11H2,1-3H3 | | InChIKey | FGJACYJASSSXNJ-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)N1CCN(CC1)c2ccccc2C=O |
| Hazard Codes | T,Xi | | Risk Statements | 25-43 | | Safety Statements | 36/37-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Skin Sens. 1 |
| | 1-Boc-4-(2-formylphenyl)piperazine Usage And Synthesis |
| Uses | 1-Boc-4-(2-formylphenyl)piperazine is used in the synthesis of melanocortin subtype-4 receptor (MC4R) agonists. MC4R is located in the hypothalamus and helps to regulate metabolism, feeding and reproductive behavior. Agonists to these receptors have shown to decrease feeding behaviors. |
| | 1-Boc-4-(2-formylphenyl)piperazine Preparation Products And Raw materials |
|