|
|
| | meso-1,2-Diphenylethylenediamine Basic information |
| Product Name: | meso-1,2-Diphenylethylenediamine | | Synonyms: | MESO-1,2-DIPHENYLETHYLENEDIAMINE;meso-1,2-diphenyl-1,2-diaminoethane;meso-1,2-Diphenylethylenediamine 98%;meso-1,2-Diphenylethylenediamine;rel-(1R,2S)-1,2-Diphenyl-1,2-ethanediamine;meso-1,2-Diphenylethylenediamine>1,2-Ethanediamine, 1,2-diphenyl-, (1R,2S)-rel-;meso-1,2-Diphenylethane-1,2-diamine | | CAS: | 951-87-1 | | MF: | C14H16N2 | | MW: | 212.29 | | EINECS: | | | Product Categories: | Nitrogen Compounds;Organic Building Blocks;Polyamines | | Mol File: | 951-87-1.mol |  |
| | meso-1,2-Diphenylethylenediamine Chemical Properties |
| Melting point | 118-122°C | | Boiling point | 353.9±37.0 °C(Predicted) | | density | 1.106±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | form | powder to crystal | | pka | 9.78±0.10(Predicted) | | color | White to Yellow to Orange | | InChI | 1S/C14H16N2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14H,15-16H2/t13-,14+ | | InChIKey | PONXTPCRRASWKW-OKILXGFUSA-N | | SMILES | N[C@H]([C@H](N)c1ccccc1)c2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2921.59.8090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | meso-1,2-Diphenylethylenediamine Usage And Synthesis |
| | meso-1,2-Diphenylethylenediamine Preparation Products And Raw materials |
|