| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | 2,3-Dimethoxy-5-methyl-6-[all trans]farnesylfarnesyl-1,4-benzoquinone Basic information |
| Product Name: | 2,3-Dimethoxy-5-methyl-6-[all trans]farnesylfarnesyl-1,4-benzoquinone | | Synonyms: | COENZYME Q6;UBIQUINONE-30;coenzyme Q6 from saccharomyces*cerevisiae;2,3-dimethoxy-5-methyl-6-(farnesylfarnesyl)-1,4-benzoquinone;ubiquinone 6;2,3-Dimethoxy-5-methyl-6-(farnesylfarnesyl)-1,4-benzoquinone, Ubiquinone-30;2-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-Hexamethyl-2,6,10,14,18,22-tetracosahexenyl]-3-methyl-5,6-dimethoxy-1,4-benzoquinone;2-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-Hexamethyl-2,6,10,14,18,22-tetracosahexenyl]-5,6-dimethoxy-3-methyl-2,5-cyclohexadiene-1,4-dione | | CAS: | 1065-31-2 | | MF: | C39H58O4 | | MW: | 590.88 | | EINECS: | | | Product Categories: | | | Mol File: | 1065-31-2.mol | ![2,3-Dimethoxy-5-methyl-6-[all trans]farnesylfarnesyl-1,4-benzoquinone Structure](CAS/GIF/1065-31-2.gif) |
| | 2,3-Dimethoxy-5-methyl-6-[all trans]farnesylfarnesyl-1,4-benzoquinone Chemical Properties |
| Boiling point | 688.7±55.0 °C(Predicted) | | density | 0.99±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | form | liquid | | color | Colorless to light yellow | | InChIKey | GXNFPEOUKFOTKY-LPHQIWJTSA-N | | SMILES | O=C(C(OC)=C1OC)C(C)=C(C/C=C(C)/CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/CCC=C(C)C)C1=O |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | 2,3-Dimethoxy-5-methyl-6-[all trans]farnesylfarnesyl-1,4-benzoquinone Usage And Synthesis |
| Uses | CoQ6 has been used:
- as an internal standard for the liquid-chromatography mass-spectrometry for the quantification of CoQ6
- to determine its effect on peroxisome proliferator-activated receptor (PPAR)
- in reversed-phase high pressure liquid chromatography to quantify yeast quinones
| | Definition | ChEBI: A ubiquinone compound having a (2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-1-yl substituent at position 2. | | General Description | Coenzyme Q6 (CoQ6) is also known as ubiquinone-30 in Saccharomyces cerevisiae. It is a flavoprotein that utilizes flavin adenine dinucleotide (FAD) as a co-factor for the synthesis of coenzyme Q. It is composed of three conserved regions- a FAD/ nicotinamide adenine dinucleotide (NAD) + hydrogen (H) (NADH) binding motif, an adenine di phosphate (ADP) binding motif and a consensus sequence, that binds to the ribityl moiety of FAD. | | Biochem/physiol Actions | Coenzyme Q6 (CoQ6) in the plasma membrane of Saccharomyces cerevisiae is involved in the ascorbate stabilization at the plasma membrane. |
| | 2,3-Dimethoxy-5-methyl-6-[all trans]farnesylfarnesyl-1,4-benzoquinone Preparation Products And Raw materials |
|