|
|
| | Disodium hexahydroxoplatinate Basic information |
| | Disodium hexahydroxoplatinate Chemical Properties |
| Melting point | 150°C | | RTECS | TP1756000 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder | | InChI | InChI=1S/Na.6O.Pt/q+1;6*-1;+4 | | InChIKey | RLMFHMIGWWZLOK-UHFFFAOYSA-N | | SMILES | [Pt+4]([O-])([O-])([O-])([O-])([O-])[O-].[Na+] | | EPA Substance Registry System | Platinate (Pt(OH)62-), disodium, (OC-6-11)- (12325-31-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | Disodium hexahydroxoplatinate Usage And Synthesis |
| reaction suitability | reagent type: catalyst core: platinum |
| | Disodium hexahydroxoplatinate Preparation Products And Raw materials |
|