|
|
| | Methyl 5-(chlorosulfonyl)-2-methyl-3-furoate Basic information |
| Product Name: | Methyl 5-(chlorosulfonyl)-2-methyl-3-furoate | | Synonyms: | METHYL 5-CHLOROSULPHONYL-2-METHYL-3-FUROATE;BUTTPARK 96\57-86;Methyl 5-(chlorosulphonyl)-2-methyl-3-furoate, 95%+;Methyl 5-(chlorosulphonyl)-2-methylfuran-3-carboxylate, 5-(Chlorosulphonyl)-3-(methoxycarbonyl)-2-methylfuran;Methyl 5-(chlorosulphonyl)-2-methylfuran-3-carboxylate;methyl 5-chlorosulfonyl-2-methylfuran-3-carboxylate;3-Furancarboxylicacid,5-(chlorosulfonyl)-2-methyl-,methylester(9CI);3-Furancarboxylic acid, 5-(chlorosulfonyl)-2-methyl-, methyl ester | | CAS: | 306936-35-6 | | MF: | C7H7ClO5S | | MW: | 238.65 | | EINECS: | | | Product Categories: | SULFONYLHALIDE | | Mol File: | 306936-35-6.mol |  |
| | Methyl 5-(chlorosulfonyl)-2-methyl-3-furoate Chemical Properties |
| Melting point | 26-27°C | | Boiling point | 335.3±42.0 °C(Predicted) | | density | 1.463±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C7H7ClO5S/c1-4-5(7(9)12-2)3-6(13-4)14(8,10)11/h3H,1-2H3 | | InChIKey | TXBNAYVBYGGPIZ-UHFFFAOYSA-N | | SMILES | COC(=O)c1cc(oc1C)S(Cl)(=O)=O |
| Hazard Codes | Xi | | Risk Statements | 34 | | Safety Statements | 26-36/37/39 | | RIDADR | 3261 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2932190090 | | Storage Class | 11 - Combustible Solids |
| | Methyl 5-(chlorosulfonyl)-2-methyl-3-furoate Usage And Synthesis |
| | Methyl 5-(chlorosulfonyl)-2-methyl-3-furoate Preparation Products And Raw materials |
|