4-(4-NITRO-PHENYL)-THIAZOL-2-YLAMINE manufacturers
|
| | 4-(4-NITRO-PHENYL)-THIAZOL-2-YLAMINE Basic information |
| | 4-(4-NITRO-PHENYL)-THIAZOL-2-YLAMINE Chemical Properties |
| Melting point | 283-287 °C | | Boiling point | 231°C (rough estimate) | | density | 1.4086 (rough estimate) | | refractive index | 1.6740 (estimate) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | solid | | pka | 3.26±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | 1S/C9H7N3O2S/c10-9-11-8(5-15-9)6-1-3-7(4-2-6)12(13)14/h1-5H,(H2,10,11) | | InChIKey | RIKJWJIWXCUKQV-UHFFFAOYSA-N | | SMILES | Nc1nc(cs1)-c2ccc(cc2)[N+]([O-])=O | | CAS DataBase Reference | 2104-09-8(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | XJ2860000 | | HazardClass | IRRITANT | | HS Code | 2934100090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-(4-NITRO-PHENYL)-THIAZOL-2-YLAMINE Usage And Synthesis |
| Uses | 4-(4-Nitrophenyl)-1,3-thiazol-2-amine is a useful reagent in the preparation of 2-?aminothiazole derivatives with biological properties. |
| | 4-(4-NITRO-PHENYL)-THIAZOL-2-YLAMINE Preparation Products And Raw materials |
|