| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3,3-Diethoxy-1,2-propanediol 1-phosphate barium salt Basic information |
| Product Name: | 3,3-Diethoxy-1,2-propanediol 1-phosphate barium salt | | Synonyms: | DL-GLYCERALDEHYDE-3-PHOSPHATEDIETHYLACETAL BARIUM SALT;DL-GLYCERALDEHYDE-3-PHOSPHATE DIETHYLACETAL BA SALT;DL-GLYCERALDEHYDE 3-PHOSPHATE DIETHYL ACETAL MONOBARIUM SALT;barium 3,3-diethoxy-2-hydroxypropyl phosphate;DL-GLYCERALDEHYDE 3-PHOSPHATE DIETHYL*AC ETAL MONOBA;DL-GLYCERALDEHYDE 3-PHOSPHATE DIETHYL-AC ETAL MONOBAR.SALT;DL-glyceraldehyde 3-phosphate diethyl acetal monobarium;DL-GLYCERALDEHYDE 3-PHOSPHATE DIETHY | | CAS: | 93965-35-6 | | MF: | C7H15BaO7P | | MW: | 379.49 | | EINECS: | 300-986-5 | | Product Categories: | | | Mol File: | 93965-35-6.mol |  |
| | 3,3-Diethoxy-1,2-propanediol 1-phosphate barium salt Chemical Properties |
| storage temp. | -20°C | | form | powder | | color | white | | InChI | 1S/C7H17O7P.Ba/c1-3-12-7(13-4-2)6(8)5-14-15(9,10)11;/h6-8H,3-5H2,1-2H3,(H2,9,10,11);/q;+2/p-2 | | InChIKey | OCALAXUAYOULKA-UHFFFAOYSA-L | | SMILES | [Ba++].CCOC(OCC)C(O)COP([O-])([O-])=O |
| Hazard Codes | Xn | | Risk Statements | 20/22 | | Safety Statements | 28 | | WGK Germany | 1 | | F | 3-10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| | 3,3-Diethoxy-1,2-propanediol 1-phosphate barium salt Usage And Synthesis |
| Uses | DL-Glyceraldehyde 3-phosphate diethyl acetal barium is an Aspartate Aminotransferase isozyme inhibitor[1]. | | Biochem/physiol Actions | DL-Glyceraldehyde 3-phosphate has been shown to function as an inhibitor of aspartate aminotransferase isozymes. | | References | [1] Mondragón L, et al. GAPDH Overexpression in the T Cell Lineage Promotes Angioimmunoblastic T Cell Lymphoma through an NF-κB-Dependent Mechanism. Cancer Cell. 2019 Sep 16;36(3):268-287.e10. DOI:10.1016/j.ccell.2019.07.008 |
| | 3,3-Diethoxy-1,2-propanediol 1-phosphate barium salt Preparation Products And Raw materials |
|