|
|
| | 4,4'-BIPHENYLDISULFONYL CHLORIDE Basic information |
| Product Name: | 4,4'-BIPHENYLDISULFONYL CHLORIDE | | Synonyms: | [1,1'-Biphenyl]-4,4'-disulfonyl dichloride;4,4'-Biphenylylenedisulfonyl chloride;p,p'-Diphenyldisulfonyl chloride;4,4'-BIPHENYLDISULFONYL DICHLORIDE;4,4'-DIPHENYLDISULFONYL CHLORIDE;4,4'-bis(phenylsulphonyl) dichloride;4,4'-Biphenyldisulphonyl chloride;4,4''-BIPHENYLDISULFONYL CHLORIDE 95+% | | CAS: | 3406-84-6 | | MF: | C12H8Cl2O4S2 | | MW: | 351.23 | | EINECS: | 222-293-6 | | Product Categories: | Biphenyls (for High-Performance Polymer Research);Functional Materials;Reagent for High-Performance Polymer Research;Organic Building Blocks;Sulfonyl Halides;Sulfur Compounds | | Mol File: | 3406-84-6.mol |  |
| | 4,4'-BIPHENYLDISULFONYL CHLORIDE Chemical Properties |
| Melting point | 205-208 °C(lit.) | | Boiling point | 476.7±38.0 °C(Predicted) | | density | 1.540±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | Water Solubility | Decomposes in contact with water,Insoluble in water | | form | powder to crystal | | color | White to Light yellow | | BRN | 2222668 | | InChI | 1S/C12H8Cl2O4S2/c13-19(15,16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)20(14,17)18/h1-8H | | InChIKey | OTFAWEIFBPUXOH-UHFFFAOYSA-N | | SMILES | ClS(=O)(=O)c1ccc(cc1)-c2ccc(cc2)S(Cl)(=O)=O | | CAS DataBase Reference | 3406-84-6(CAS DataBase Reference) | | EPA Substance Registry System | [1,1'-Biphenyl]-4,4'-disulfonyl dichloride (3406-84-6) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 4,4'-BIPHENYLDISULFONYL CHLORIDE Usage And Synthesis |
| Uses | Biphenyl-4,4′-disulfonyl chloride was used in the synthesis of 6A,6D-diamino-6A,6D-dideoxy-β-cyclodextrin. | | General Description | Biphenyl-4,4′-disulfonyl chloride reacts with cycloinulohexaose in pyridine to form capped cyclofructan, 6A,6C-di-O-(biphenyl-4,4′-disulfonyl)-cycloinulohexaose. |
| | 4,4'-BIPHENYLDISULFONYL CHLORIDE Preparation Products And Raw materials |
|