| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Bis(ethylenedithio)tetrathiafulvalene manufacturers
|
| | Bis(ethylenedithio)tetrathiafulvalene Basic information |
| Product Name: | Bis(ethylenedithio)tetrathiafulvalene | | Synonyms: | BIS-ETHYLENDITHIO-TETRATHIAFULVALENE;BI[5,6-DIHYDRO-1,3-DITHIOLO[4,5-B][1,4]-DITHIINE-2-YLIDENE];BIS(ETHYLENEDITHIO)TETRATHIAFULVALENE, 9 8%;Bis(ethylenedithia)tetrathiafulvalene;Bis(ethylenedithio)tetrathiafulvalene [Organic Electronic Material];BEDT-TTF, Bi[5,6-dihydro-1,3-dithiolo[4,5-b][1,4]-dithiine-2-ylidene];2-(5,6-Dihydro-1,3-dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5,6-dihydro-1,3-dithiolo[4,5-b][1,4]dithiin;Bis(ethylendithiolo)tetrathiafulvalene | | CAS: | 66946-48-3 | | MF: | C10H8S8 | | MW: | 384.7 | | EINECS: | | | Product Categories: | Sulphur Derivatives;Donors (Charge Transfer Complexes);TTF Derivatives;Charge Transfer Complexes for Organic Metals;Functional Materials | | Mol File: | 66946-48-3.mol |  |
| | Bis(ethylenedithio)tetrathiafulvalene Chemical Properties |
| Melting point | ~260 °C (dec.)(lit.) | | Boiling point | 471.31°C (rough estimate) | | density | 1.9349 (rough estimate) | | refractive index | 1.6000 (estimate) | | solubility | Soluble in organic solvents. | | form | Powder | | color | Orange to Amber to Dark red | | BRN | 1653830 | | InChI | 1S/C10H8S8/c1-2-12-6-5(11-1)15-9(16-6)10-17-7-8(18-10)14-4-3-13-7/h1-4H2 | | InChIKey | LZJCVNLYDXCIBG-UHFFFAOYSA-N | | SMILES | C1CSC2=C(S1)S\C(S2)=C3\SC4=C(SCCS4)S3 | | CAS DataBase Reference | 66946-48-3(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 8-9-23 | | HS Code | 2934.99.9001 | | Storage Class | 11 - Combustible Solids |
| | Bis(ethylenedithio)tetrathiafulvalene Usage And Synthesis |
| Chemical Properties | RED LUSTROUS NEEDLES | | Uses | It is used as a component for organic superconductors. | | General Description | Bis(ethylenedithio)tetrathiafulvalene (BEDT-TTF) is an organic superconducting polymer that is used as an electron donor with a superconducting transition temperature (Tc) of 10K. |
| | Bis(ethylenedithio)tetrathiafulvalene Preparation Products And Raw materials |
|