BISMUTH AMMONIUM CITRATE Extra Pure manufacturers
|
| | BISMUTH AMMONIUM CITRATE Extra Pure Basic information |
| Product Name: | BISMUTH AMMONIUM CITRATE Extra Pure | | Synonyms: | CITRIC ACID AMMONIUM BISMUTH SALT;BISMUTH AMMONIUM CITRATE;AMMONIUM BISMUTH CITRATE;Ammonium bismuth citrate monohydrate;Ammonium bismuth citrate, Bi 48-52%, water ca 2%;AMMONIUM BISMUTH CITRATE, CULTURE MEDIA, BASE INGREDIENT;BismuthAmmoniumCitrateExtraPure;Ammonium bismuth citrate (Bi 50-52%) | | CAS: | 31886-41-6 | | MF: | C6H11BiNO7 | | MW: | 418.13 | | EINECS: | 250-856-6 | | Product Categories: | | | Mol File: | 31886-41-6.mol |  |
| | BISMUTH AMMONIUM CITRATE Extra Pure Chemical Properties |
| density | 1.8 | | form | Solid | | color | White powder | | Odor | Odorless | | Water Solubility | Soluble in water | | Major Application | microbiology | | InChI | InChI=1S/C6H8O7.Bi.H3N.3H/c7-3(8)1-6(13,5(11)12)2-4(9)10;;;;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;1H3;;; | | InChIKey | QSBNOZODKXUXSP-UHFFFAOYSA-K | | SMILES | C(O)(C(=O)O)(CC(=O)O)CC(=O)O.[BiH3].N | | CAS DataBase Reference | 31886-41-6(CAS DataBase Reference) |
| Risk Statements | 20/21/22 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | BISMUTH AMMONIUM CITRATE Extra Pure Usage And Synthesis |
| Uses | Ammonium bismuth citrate is used in microbiological culture media as a selective agent. It is for example used in Bismuth sulfite agar for the isolation of Salmonella typhi and other salmonellae from food and other materials, sewage and water. It is as well used in the Nickerson Agar (BIGGY), which is used for the isolation and identification of Candida species | | General Description | Ammonium bismuth citrate is used in microbiological culture media as a selective agent as it inhibits certain gram-negative and gram-positive bacteria. The bismuth ions are reduced to metallic bismuth, which impart metallic sheen around the colonies. |
| | BISMUTH AMMONIUM CITRATE Extra Pure Preparation Products And Raw materials |
|